C18H20F2N3O3+ — CID 9023992
[2-(4-carbamoylanilino)-2-oxoethyl]-[[4-(difluoromethoxy)phenyl]methyl]-methylazanium (PubChem CID 9023992) has the molecular formula C18H20F2N3O3+ and a molecular weight of 364.37 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl]-[[4-(difluoromethoxy)phenyl]methyl]-methylazanium.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl]-[[4-(difluoromethoxy)phenyl]methyl]-methylazanium |
|---|---|
| PubChem CID | 9023992 |
| Molecular Formula | C18H20F2N3O3+ |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl]-[[4-(difluoromethoxy)phenyl]methyl]-methylazanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(C(N)=O)cc1)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H19F2N3O3/c1-23(10-12-2-8-15(9-3-12)26-18(19)20)11-16(24)22-14-6-4-13(5-7-14)17(21)25/h2-9,18H,10-11H2,1H3,(H2,21,25)(H,22,24)/p+1 |
| InChIKey | WHRDEKWURGSFNN-UHFFFAOYSA-O |
| XLogP | 1.04 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |