C20H25F2N2O2+ — CID 9028860
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]-methyl-[(4-propan-2-ylphenyl)methyl]azanium (PubChem CID 9028860) has the molecular formula C20H25F2N2O2+ and a molecular weight of 363.43 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl]-methyl-[(4-propan-2-ylphenyl)methyl]azanium.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl]-methyl-[(4-propan-2-ylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9028860 |
| Molecular Formula | C20H25F2N2O2+ |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl]-methyl-[(4-propan-2-ylphenyl)methyl]azanium |
| SMILES | CC(C)c1ccc(C[NH+](C)CC(=O)Nc2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H24F2N2O2/c1-14(2)16-6-4-15(5-7-16)12-24(3)13-19(25)23-17-8-10-18(11-9-17)26-20(21)22/h4-11,14,20H,12-13H2,1-3H3,(H,23,25)/p+1 |
| InChIKey | GIJSNHJAVYGYDF-UHFFFAOYSA-O |
| XLogP | 3.06 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |