C17H17ClF2N3O4+ — CID 9024107
[2-(2-chloro-4-nitroanilino)-2-oxoethyl]-[[4-(difluoromethoxy)phenyl]methyl]-methylazanium (PubChem CID 9024107) has the molecular formula C17H17ClF2N3O4+ and a molecular weight of 400.79 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxoethyl]-[[4-(difluoromethoxy)phenyl]methyl]-methylazanium.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl]-[[4-(difluoromethoxy)phenyl]methyl]-methylazanium |
|---|---|
| PubChem CID | 9024107 |
| Molecular Formula | C17H17ClF2N3O4+ |
| Molecular Weight | 400.79 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl]-[[4-(difluoromethoxy)phenyl]methyl]-methylazanium |
| SMILES | C[NH+](CC(=O)Nc1ccc([N+](=O)[O-])cc1Cl)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H16ClF2N3O4/c1-22(9-11-2-5-13(6-3-11)27-17(19)20)10-16(24)21-15-7-4-12(23(25)26)8-14(15)18/h2-8,17H,9-10H2,1H3,(H,21,24)/p+1 |
| InChIKey | JWFLCFJDRSWPKG-UHFFFAOYSA-O |
| XLogP | 2.50 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.79 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|