C20H24ClN4O4+ — CID 9339514
[2-(2-chloro-4-nitroanilino)-2-oxoethyl]-methyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]azanium (PubChem CID 9339514) has the molecular formula C20H24ClN4O4+ and a molecular weight of 419.89 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxoethyl]-methyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]azanium.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl]-methyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9339514 |
| Molecular Formula | C20H24ClN4O4+ |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl]-methyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]azanium |
| SMILES | Cc1cc(C)c(NC(=O)C[NH+](C)CC(=O)Nc2ccc([N+](=O)[O-])cc2Cl)c(C)c1 |
| InChI | InChI=1S/C20H23ClN4O4/c1-12-7-13(2)20(14(3)8-12)23-19(27)11-24(4)10-18(26)22-17-6-5-15(25(28)29)9-16(17)21/h5-9H,10-11H2,1-4H3,(H,22,26)(H,23,27)/p+1 |
| InChIKey | BAVPFCQFZAZKDU-UHFFFAOYSA-O |
| XLogP | 2.27 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|