C17H17Cl2N4O4+ — CID 9037855
[2-(2-chloroanilino)-2-oxoethyl]-[2-(2-chloro-4-nitroanilino)-2-oxoethyl]-methylazanium (PubChem CID 9037855) has the molecular formula C17H17Cl2N4O4+ and a molecular weight of 412.25 g/mol. Its IUPAC name is [2-(2-chloroanilino)-2-oxoethyl]-[2-(2-chloro-4-nitroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(2-chloroanilino)-2-oxoethyl]-[2-(2-chloro-4-nitroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9037855 |
| Molecular Formula | C17H17Cl2N4O4+ |
| Molecular Weight | 412.25 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | [2-(2-chloroanilino)-2-oxoethyl]-[2-(2-chloro-4-nitroanilino)-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)Nc1ccccc1Cl)CC(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C17H16Cl2N4O4/c1-22(9-16(24)20-14-5-3-2-4-12(14)18)10-17(25)21-15-7-6-11(23(26)27)8-13(15)19/h2-8H,9-10H2,1H3,(H,20,24)(H,21,25)/p+1 |
| InChIKey | FYJWGJJRRQRCRN-UHFFFAOYSA-O |
| XLogP | 1.99 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|