C18H21BrN3O3+ — CID 2657721
(5-bromo-2-methoxyphenyl)methyl-[2-(4-carbamoylanilino)-2-oxoethyl]-methylazanium (PubChem CID 2657721) has the molecular formula C18H21BrN3O3+ and a molecular weight of 407.29 g/mol. Its IUPAC name is (5-bromo-2-methoxyphenyl)methyl-[2-(4-carbamoylanilino)-2-oxoethyl]-methylazanium.
| Compound Name | (5-bromo-2-methoxyphenyl)methyl-[2-(4-carbamoylanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 2657721 |
| Molecular Formula | C18H21BrN3O3+ |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | (5-bromo-2-methoxyphenyl)methyl-[2-(4-carbamoylanilino)-2-oxoethyl]-methylazanium |
| SMILES | COc1ccc(Br)cc1C[NH+](C)CC(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C18H20BrN3O3/c1-22(10-13-9-14(19)5-8-16(13)25-2)11-17(23)21-15-6-3-12(4-7-15)18(20)24/h3-9H,10-11H2,1-2H3,(H2,20,24)(H,21,23)/p+1 |
| InChIKey | PVKFGNKWXNWYIK-UHFFFAOYSA-O |
| XLogP | 1.21 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |