C15H23BrN3O3+ — CID 9103818
(5-bromo-2-methoxyphenyl)methyl-methyl-[2-oxo-2-(propylcarbamoylamino)ethyl]azanium (PubChem CID 9103818) has the molecular formula C15H23BrN3O3+ and a molecular weight of 373.27 g/mol. Its IUPAC name is (5-bromo-2-methoxyphenyl)methyl-methyl-[2-oxo-2-(propylcarbamoylamino)ethyl]azanium.
| Compound Name | (5-bromo-2-methoxyphenyl)methyl-methyl-[2-oxo-2-(propylcarbamoylamino)ethyl]azanium |
|---|---|
| PubChem CID | 9103818 |
| Molecular Formula | C15H23BrN3O3+ |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (5-bromo-2-methoxyphenyl)methyl-methyl-[2-oxo-2-(propylcarbamoylamino)ethyl]azanium |
| SMILES | CCCNC(=O)NC(=O)C[NH+](C)Cc1cc(Br)ccc1OC |
| InChI | InChI=1S/C15H22BrN3O3/c1-4-7-17-15(21)18-14(20)10-19(2)9-11-8-12(16)5-6-13(11)22-3/h5-6,8H,4,7,9-10H2,1-3H3,(H2,17,18,20,21)/p+1 |
| InChIKey | JLNWUGNMVCFYMH-UHFFFAOYSA-O |
| XLogP | 0.71 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |