C16H19BrN2O5 — CID 6211994
[2-oxo-2-(propylcarbamoylamino)ethyl] (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate (PubChem CID 6211994) has the molecular formula C16H19BrN2O5 and a molecular weight of 399.24 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6211994 |
| Molecular Formula | C16H19BrN2O5 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)/C=C/c1cc(Br)ccc1OC |
| InChI | InChI=1S/C16H19BrN2O5/c1-3-8-18-16(22)19-14(20)10-24-15(21)7-4-11-9-12(17)5-6-13(11)23-2/h4-7,9H,3,8,10H2,1-2H3,(H2,18,19,20,22)/b7-4+ |
| InChIKey | UWMNPNLVQRBHBT-QPJJXVBHSA-N |
| XLogP | 2.25 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|