C17H20BrFN2O4 — CID 2498070
[2-(3-methylbutylcarbamoylamino)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate (PubChem CID 2498070) has the molecular formula C17H20BrFN2O4 and a molecular weight of 415.26 g/mol. Its IUPAC name is [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2498070 |
| Molecular Formula | C17H20BrFN2O4 |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
| SMILES | CC(C)CCNC(=O)NC(=O)COC(=O)/C=C/c1cc(Br)ccc1F |
| InChI | InChI=1S/C17H20BrFN2O4/c1-11(2)7-8-20-17(24)21-15(22)10-25-16(23)6-3-12-9-13(18)4-5-14(12)19/h3-6,9,11H,7-8,10H2,1-2H3,(H2,20,21,22,24)/b6-3+ |
| InChIKey | NEGGUHJEGRCPJC-ZZXKWVIFSA-N |
| XLogP | 3.02 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|