C16H15BrFN3O3 — CID 55469141
[2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate (PubChem CID 55469141) has the molecular formula C16H15BrFN3O3 and a molecular weight of 396.22 g/mol. Its IUPAC name is [2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate.
| Compound Name | [2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 55469141 |
| Molecular Formula | C16H15BrFN3O3 |
| Molecular Weight | 396.22 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | [2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
| SMILES | Cc1cc(NC(=O)COC(=O)/C=C/c2cc(Br)ccc2F)n(C)n1 |
| InChI | InChI=1S/C16H15BrFN3O3/c1-10-7-14(21(2)20-10)19-15(22)9-24-16(23)6-3-11-8-12(17)4-5-13(11)18/h3-8H,9H2,1-2H3,(H,19,22)/b6-3+ |
| InChIKey | VRHCSTSEJGVVDT-ZZXKWVIFSA-N |
| XLogP | 2.83 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|