C18H14BrClFNO5S — CID 42976177
[2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate (PubChem CID 42976177) has the molecular formula C18H14BrClFNO5S and a molecular weight of 490.73 g/mol. Its IUPAC name is [2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 42976177 |
| Molecular Formula | C18H14BrClFNO5S |
| Molecular Weight | 490.73 g/mol |
| Exact Mass | 488.94 |
| IUPAC Name | [2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(NC(=O)COC(=O)/C=C/c2cc(Br)ccc2F)c1 |
| InChI | InChI=1S/C18H14BrClFNO5S/c1-28(25,26)13-4-5-14(20)16(9-13)22-17(23)10-27-18(24)7-2-11-8-12(19)3-6-15(11)21/h2-9H,10H2,1H3,(H,22,23)/b7-2+ |
| InChIKey | SCIKNSUMKOXHJZ-FARCUNLSSA-N |
| XLogP | 3.84 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.73 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|