C17H17BrFNO3 — CID 55312653
[2-[bis(prop-2-enyl)amino]-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate (PubChem CID 55312653) has the molecular formula C17H17BrFNO3 and a molecular weight of 382.23 g/mol. Its IUPAC name is [2-[bis(prop-2-enyl)amino]-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate.
| Compound Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 55312653 |
| Molecular Formula | C17H17BrFNO3 |
| Molecular Weight | 382.23 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
| SMILES | C=CCN(CC=C)C(=O)COC(=O)/C=C/c1cc(Br)ccc1F |
| InChI | InChI=1S/C17H17BrFNO3/c1-3-9-20(10-4-2)16(21)12-23-17(22)8-5-13-11-14(18)6-7-15(13)19/h3-8,11H,1-2,9-10,12H2/b8-5+ |
| InChIKey | UTXUIPGMMORSDQ-VMPITWQZSA-N |
| XLogP | 3.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|