C17H18BrN3O3 — CID 8600801
[2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] (E)-3-(4-bromophenyl)prop-2-enoate (PubChem CID 8600801) has the molecular formula C17H18BrN3O3 and a molecular weight of 392.25 g/mol. Its IUPAC name is [2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] (E)-3-(4-bromophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] (E)-3-(4-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8600801 |
| Molecular Formula | C17H18BrN3O3 |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | [2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] (E)-3-(4-bromophenyl)prop-2-enoate |
| SMILES | Cc1nn(C)c(C)c1NC(=O)COC(=O)/C=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H18BrN3O3/c1-11-17(12(2)21(3)20-11)19-15(22)10-24-16(23)9-6-13-4-7-14(18)8-5-13/h4-9H,10H2,1-3H3,(H,19,22)/b9-6+ |
| InChIKey | WSKABNNQLTVAIL-RMKNXTFCSA-N |
| XLogP | 2.99 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|