C20H24ClN3O5 — CID 8603291
[2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate (PubChem CID 8603291) has the molecular formula C20H24ClN3O5 and a molecular weight of 421.88 g/mol. Its IUPAC name is [2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8603291 |
| Molecular Formula | C20H24ClN3O5 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | [2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1c(Cl)cc(/C=C/C(=O)OCC(=O)Nc2c(C)nn(C)c2C)cc1OC |
| InChI | InChI=1S/C20H24ClN3O5/c1-6-28-20-15(21)9-14(10-16(20)27-5)7-8-18(26)29-11-17(25)22-19-12(2)23-24(4)13(19)3/h7-10H,6,11H2,1-5H3,(H,22,25)/b8-7+ |
| InChIKey | XGGFDUIUHXIAKH-BQYQJAHWSA-N |
| XLogP | 3.29 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|