C22H21N3O3 — CID 7860706
[2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] (E)-3-phenylprop-2-enoate (PubChem CID 7860706) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 7860706 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] (E)-3-phenylprop-2-enoate |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1NC(=O)COC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H21N3O3/c1-16-22(17(2)25(24-16)19-11-7-4-8-12-19)23-20(26)15-28-21(27)14-13-18-9-5-3-6-10-18/h3-14H,15H2,1-2H3,(H,23,26)/b14-13+ |
| InChIKey | FOQXVAHOIXVRFP-BUHFOSPRSA-N |
| XLogP | 3.68 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|