C21H18BrNO7 — CID 71954174
dimethyl 5-[[2-[3-(4-bromophenyl)prop-2-enoyloxy]acetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 71954174) has the molecular formula C21H18BrNO7 and a molecular weight of 476.28 g/mol. Its IUPAC name is dimethyl 5-[[2-[3-(4-bromophenyl)prop-2-enoyloxy]acetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-[3-(4-bromophenyl)prop-2-enoyloxy]acetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 71954174 |
| Molecular Formula | C21H18BrNO7 |
| Molecular Weight | 476.28 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | dimethyl 5-[[2-[3-(4-bromophenyl)prop-2-enoyloxy]acetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)COC(=O)C=Cc2ccc(Br)cc2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C21H18BrNO7/c1-28-20(26)14-9-15(21(27)29-2)11-17(10-14)23-18(24)12-30-19(25)8-5-13-3-6-16(22)7-4-13/h3-11H,12H2,1-2H3,(H,23,24) |
| InChIKey | GNCWJPUHLAKXIG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|