C18H23NO7 — CID 7950752
dimethyl 5-[[2-(3,3-dimethylbutanoyloxy)acetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 7950752) has the molecular formula C18H23NO7 and a molecular weight of 365.38 g/mol. Its IUPAC name is dimethyl 5-[[2-(3,3-dimethylbutanoyloxy)acetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-(3,3-dimethylbutanoyloxy)acetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 7950752 |
| Molecular Formula | C18H23NO7 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | dimethyl 5-[[2-(3,3-dimethylbutanoyloxy)acetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)COC(=O)CC(C)(C)C)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C18H23NO7/c1-18(2,3)9-15(21)26-10-14(20)19-13-7-11(16(22)24-4)6-12(8-13)17(23)25-5/h6-8H,9-10H2,1-5H3,(H,19,20) |
| InChIKey | CMYBVDYOYHNKHC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|