C23H25NO8 — CID 55317889
dimethyl 5-[[2-[3-(2,5-dimethylphenoxy)propanoyloxy]acetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 55317889) has the molecular formula C23H25NO8 and a molecular weight of 443.45 g/mol. Its IUPAC name is dimethyl 5-[[2-[3-(2,5-dimethylphenoxy)propanoyloxy]acetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-[3-(2,5-dimethylphenoxy)propanoyloxy]acetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 55317889 |
| Molecular Formula | C23H25NO8 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | dimethyl 5-[[2-[3-(2,5-dimethylphenoxy)propanoyloxy]acetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)COC(=O)CCOc2cc(C)ccc2C)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C23H25NO8/c1-14-5-6-15(2)19(9-14)31-8-7-21(26)32-13-20(25)24-18-11-16(22(27)29-3)10-17(12-18)23(28)30-4/h5-6,9-12H,7-8,13H2,1-4H3,(H,24,25) |
| InChIKey | XPFBDQNHNFOPLW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|