C22H23NO9 — CID 55316570
dimethyl 5-[[2-[3-(4-methoxyphenoxy)propanoyloxy]acetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 55316570) has the molecular formula C22H23NO9 and a molecular weight of 445.42 g/mol. Its IUPAC name is dimethyl 5-[[2-[3-(4-methoxyphenoxy)propanoyloxy]acetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-[3-(4-methoxyphenoxy)propanoyloxy]acetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 55316570 |
| Molecular Formula | C22H23NO9 |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | dimethyl 5-[[2-[3-(4-methoxyphenoxy)propanoyloxy]acetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)COC(=O)CCOc2ccc(OC)cc2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C22H23NO9/c1-28-17-4-6-18(7-5-17)31-9-8-20(25)32-13-19(24)23-16-11-14(21(26)29-2)10-15(12-16)22(27)30-3/h4-7,10-12H,8-9,13H2,1-3H3,(H,23,24) |
| InChIKey | DYRYFEXCCANEOC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|