C17H16N4O7 — CID 2684846
dimethyl 5-[[2-(3-aminopyrazine-2-carbonyl)oxyacetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 2684846) has the molecular formula C17H16N4O7 and a molecular weight of 388.34 g/mol. Its IUPAC name is dimethyl 5-[[2-(3-aminopyrazine-2-carbonyl)oxyacetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-(3-aminopyrazine-2-carbonyl)oxyacetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 2684846 |
| Molecular Formula | C17H16N4O7 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | dimethyl 5-[[2-(3-aminopyrazine-2-carbonyl)oxyacetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)COC(=O)c2nccnc2N)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C17H16N4O7/c1-26-15(23)9-5-10(16(24)27-2)7-11(6-9)21-12(22)8-28-17(25)13-14(18)20-4-3-19-13/h3-7H,8H2,1-2H3,(H2,18,20)(H,21,22) |
| InChIKey | QCNWNAMQNRLBCR-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 159.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|