C13H10ClN5O5 — CID 2686440
[2-(4-chloro-3-nitroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate (PubChem CID 2686440) has the molecular formula C13H10ClN5O5 and a molecular weight of 351.71 g/mol. Its IUPAC name is [2-(4-chloro-3-nitroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate.
| Compound Name | [2-(4-chloro-3-nitroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 2686440 |
| Molecular Formula | C13H10ClN5O5 |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | [2-(4-chloro-3-nitroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate |
| SMILES | Nc1nccnc1C(=O)OCC(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10ClN5O5/c14-8-2-1-7(5-9(8)19(22)23)18-10(20)6-24-13(21)11-12(15)17-4-3-16-11/h1-5H,6H2,(H2,15,17)(H,18,20) |
| InChIKey | IXJRDGFEYMCSLS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|