C19H23N5O6S — CID 41379433
[2-(4-methoxy-3-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate (PubChem CID 41379433) has the molecular formula C19H23N5O6S and a molecular weight of 449.49 g/mol. Its IUPAC name is [2-(4-methoxy-3-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate.
| Compound Name | [2-(4-methoxy-3-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 41379433 |
| Molecular Formula | C19H23N5O6S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | [2-(4-methoxy-3-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2nccnc2N)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H23N5O6S/c1-29-14-6-5-13(11-15(14)31(27,28)24-9-3-2-4-10-24)23-16(25)12-30-19(26)17-18(20)22-8-7-21-17/h5-8,11H,2-4,9-10,12H2,1H3,(H2,20,22)(H,23,25) |
| InChIKey | FSERYXWOEWBLJU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 153.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |