C22H31N3O7S — CID 42980856
[2-(4-methoxy-3-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate (PubChem CID 42980856) has the molecular formula C22H31N3O7S and a molecular weight of 481.57 g/mol. Its IUPAC name is [2-(4-methoxy-3-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate.
| Compound Name | [2-(4-methoxy-3-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
|---|---|
| PubChem CID | 42980856 |
| Molecular Formula | C22H31N3O7S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | [2-(4-methoxy-3-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
| SMILES | COc1ccc(NC(=O)COC(=O)CN2CCCCCC2=O)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H31N3O7S/c1-31-18-10-9-17(14-19(18)33(29,30)25-12-6-3-7-13-25)23-20(26)16-32-22(28)15-24-11-5-2-4-8-21(24)27/h9-10,14H,2-8,11-13,15-16H2,1H3,(H,23,26) |
| InChIKey | ALZRUTYMXBDANS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |