C23H22ClNO9 — CID 41070385
dimethyl 5-[[2-[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]oxyacetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 41070385) has the molecular formula C23H22ClNO9 and a molecular weight of 491.88 g/mol. Its IUPAC name is dimethyl 5-[[2-[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]oxyacetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]oxyacetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 41070385 |
| Molecular Formula | C23H22ClNO9 |
| Molecular Weight | 491.88 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | dimethyl 5-[[2-[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]oxyacetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)COC(=O)/C=C/c2cc(Cl)c(OC)c(OC)c2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C23H22ClNO9/c1-30-18-8-13(7-17(24)21(18)31-2)5-6-20(27)34-12-19(26)25-16-10-14(22(28)32-3)9-15(11-16)23(29)33-4/h5-11H,12H2,1-4H3,(H,25,26)/b6-5+ |
| InChIKey | JNAWXLWITDUAPO-AATRIKPKSA-N |
| XLogP | 3.13 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.88 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|