C15H17ClN2O6 — CID 3893921
[2-(methylcarbamoylamino)-2-oxoethyl] 3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 3893921) has the molecular formula C15H17ClN2O6 and a molecular weight of 356.76 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3893921 |
| Molecular Formula | C15H17ClN2O6 |
| Molecular Weight | 356.76 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | CNC(=O)NC(=O)COC(=O)C=Cc1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H17ClN2O6/c1-17-15(21)18-12(19)8-24-13(20)5-4-9-6-10(16)14(23-3)11(7-9)22-2/h4-7H,8H2,1-3H3,(H2,17,18,19,21) |
| InChIKey | TTWAAIABMKPDBH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.76 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|