C19H19ClN2O6S — CID 27278155
[2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 27278155) has the molecular formula C19H19ClN2O6S and a molecular weight of 438.89 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 27278155 |
| Molecular Formula | C19H19ClN2O6S |
| Molecular Weight | 438.89 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)NC(=O)NCc2cccs2)cc(Cl)c1OC |
| InChI | InChI=1S/C19H19ClN2O6S/c1-26-15-9-12(8-14(20)18(15)27-2)5-6-17(24)28-11-16(23)22-19(25)21-10-13-4-3-7-29-13/h3-9H,10-11H2,1-2H3,(H2,21,22,23,25)/b6-5+ |
| InChIKey | ZLTAFTZOZRWDCO-AATRIKPKSA-N |
| XLogP | 3.00 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.89 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|