C12H13BrN2O3 — CID 78911973
N-(2-amino-2-oxoethyl)-3-(5-bromo-2-methoxyphenyl)prop-2-enamide (PubChem CID 78911973) has the molecular formula C12H13BrN2O3 and a molecular weight of 313.15 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-(5-bromo-2-methoxyphenyl)prop-2-enamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-(5-bromo-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 78911973 |
| Molecular Formula | C12H13BrN2O3 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-(5-bromo-2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(Br)cc1C=CC(=O)NCC(N)=O |
| InChI | InChI=1S/C12H13BrN2O3/c1-18-10-4-3-9(13)6-8(10)2-5-12(17)15-7-11(14)16/h2-6H,7H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | QNUDPVFHYQIUNX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|