C15H20BrNO3 — CID 107318684
(E)-3-(5-bromo-2-methoxyphenyl)-N-(5-hydroxypentyl)prop-2-enamide (PubChem CID 107318684) has the molecular formula C15H20BrNO3 and a molecular weight of 342.23 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-methoxyphenyl)-N-(5-hydroxypentyl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-(5-hydroxypentyl)prop-2-enamide |
|---|---|
| PubChem CID | 107318684 |
| Molecular Formula | C15H20BrNO3 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-(5-hydroxypentyl)prop-2-enamide |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)NCCCCCO |
| InChI | InChI=1S/C15H20BrNO3/c1-20-14-7-6-13(16)11-12(14)5-8-15(19)17-9-3-2-4-10-18/h5-8,11,18H,2-4,9-10H2,1H3,(H,17,19)/b8-5+ |
| InChIKey | HZCGTGOKHXYMNF-VMPITWQZSA-N |
| XLogP | 2.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|