C15H18BrNO4 — CID 76930220
ethyl 3-[3-(5-bromo-2-methoxyphenyl)prop-2-enoylamino]propanoate (PubChem CID 76930220) has the molecular formula C15H18BrNO4 and a molecular weight of 356.22 g/mol. Its IUPAC name is ethyl 3-[3-(5-bromo-2-methoxyphenyl)prop-2-enoylamino]propanoate.
| Compound Name | ethyl 3-[3-(5-bromo-2-methoxyphenyl)prop-2-enoylamino]propanoate |
|---|---|
| PubChem CID | 76930220 |
| Molecular Formula | C15H18BrNO4 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | ethyl 3-[3-(5-bromo-2-methoxyphenyl)prop-2-enoylamino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)C=Cc1cc(Br)ccc1OC |
| InChI | InChI=1S/C15H18BrNO4/c1-3-21-15(19)8-9-17-14(18)7-4-11-10-12(16)5-6-13(11)20-2/h4-7,10H,3,8-9H2,1-2H3,(H,17,18) |
| InChIKey | IAXNRJTXBSQFPS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|