C11H12BrN3O2 — CID 11358434
(E)-3-(5-bromo-2-methoxyphenyl)-N-(diaminomethylidene)prop-2-enamide (PubChem CID 11358434) has the molecular formula C11H12BrN3O2 and a molecular weight of 298.14 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-methoxyphenyl)-N-(diaminomethylidene)prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-(diaminomethylidene)prop-2-enamide |
|---|---|
| PubChem CID | 11358434 |
| Molecular Formula | C11H12BrN3O2 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-(diaminomethylidene)prop-2-enamide |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)N=C(N)N |
| InChI | InChI=1S/C11H12BrN3O2/c1-17-9-4-3-8(12)6-7(9)2-5-10(16)15-11(13)14/h2-6H,1H3,(H4,13,14,15,16)/b5-2+ |
| InChIKey | IZTOMICYUSXUFV-GORDUTHDSA-N |
| XLogP | 1.27 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|