C9H12BrN4O+ — CID 11865261
(Z)-(5-bromo-2-methoxyphenyl)methylidene-(diaminomethylideneamino)azanium (PubChem CID 11865261) has the molecular formula C9H12BrN4O+ and a molecular weight of 272.13 g/mol. Its IUPAC name is (Z)-(5-bromo-2-methoxyphenyl)methylidene-(diaminomethylideneamino)azanium.
| Compound Name | (Z)-(5-bromo-2-methoxyphenyl)methylidene-(diaminomethylideneamino)azanium |
|---|---|
| PubChem CID | 11865261 |
| Molecular Formula | C9H12BrN4O+ |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | (Z)-(5-bromo-2-methoxyphenyl)methylidene-(diaminomethylideneamino)azanium |
| SMILES | COc1ccc(Br)cc1/C=[NH+]\N=C(N)N |
| InChI | InChI=1S/C9H11BrN4O/c1-15-8-3-2-7(10)4-6(8)5-13-14-9(11)12/h2-5H,1H3,(H4,11,12,14)/p+1/b13-5- |
| InChIKey | XCTZQILYVRTVHP-ACAGNQJTSA-O |
| XLogP | -0.85 |
| TPSA | 87.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|