C10H15N4O3+ — CID 135852459
(E)-(diaminomethylideneamino)-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]azanium (PubChem CID 135852459) has the molecular formula C10H15N4O3+ and a molecular weight of 239.26 g/mol. Its IUPAC name is (E)-(diaminomethylideneamino)-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]azanium.
| Compound Name | (E)-(diaminomethylideneamino)-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]azanium |
|---|---|
| PubChem CID | 135852459 |
| Molecular Formula | C10H15N4O3+ |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | (E)-(diaminomethylideneamino)-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]azanium |
| SMILES | COc1cc(/C=[NH+]/N=C(N)N)cc(OC)c1O |
| InChI | InChI=1S/C10H14N4O3/c1-16-7-3-6(5-13-14-10(11)12)4-8(17-2)9(7)15/h3-5,15H,1-2H3,(H4,11,12,14)/p+1/b13-5+ |
| InChIKey | SXXCDAJIUZFALD-WLRTZDKTSA-O |
| XLogP | -1.90 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|