C10H14N4O3 — CID 2387812
2-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]guanidine (PubChem CID 2387812) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]guanidine.
| Compound Name | 2-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 2387812 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]guanidine |
| SMILES | COc1cc(C=NN=C(N)N)cc(OC)c1O |
| InChI | InChI=1S/C10H14N4O3/c1-16-7-3-6(5-13-14-10(11)12)4-8(17-2)9(7)15/h3-5,15H,1-2H3,(H4,11,12,14) |
| InChIKey | SXXCDAJIUZFALD-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|