C17H20ClN5O6 — CID 137055372
1,2-bis[(3,4-dihydroxy-5-methoxyphenyl)methylideneamino]guanidine;hydrochloride (PubChem CID 137055372) has the molecular formula C17H20ClN5O6 and a molecular weight of 425.83 g/mol. Its IUPAC name is 1,2-bis[(3,4-dihydroxy-5-methoxyphenyl)methylideneamino]guanidine;hydrochloride.
| Compound Name | 1,2-bis[(3,4-dihydroxy-5-methoxyphenyl)methylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 137055372 |
| Molecular Formula | C17H20ClN5O6 |
| Molecular Weight | 425.83 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 1,2-bis[(3,4-dihydroxy-5-methoxyphenyl)methylideneamino]guanidine;hydrochloride |
| SMILES | COc1cc(C=N/N=C(\N)NN=Cc2cc(O)c(O)c(OC)c2)cc(O)c1O.Cl |
| InChI | InChI=1S/C17H19N5O6.ClH/c1-27-13-5-9(3-11(23)15(13)25)7-19-21-17(18)22-20-8-10-4-12(24)16(26)14(6-10)28-2;/h3-8,23-26H,1-2H3,(H3,18,21,22);1H |
| InChIKey | YNYZSTUTOLRTGA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 174.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.83 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|