C19H21Br2N5O4 — CID 161283561
1,2-bis[(3-bromo-4,5-dimethoxyphenyl)methylideneamino]guanidine (PubChem CID 161283561) has the molecular formula C19H21Br2N5O4 and a molecular weight of 543.22 g/mol. Its IUPAC name is 1,2-bis[(3-bromo-4,5-dimethoxyphenyl)methylideneamino]guanidine.
| Compound Name | 1,2-bis[(3-bromo-4,5-dimethoxyphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 161283561 |
| Molecular Formula | C19H21Br2N5O4 |
| Molecular Weight | 543.22 g/mol |
| Exact Mass | 541.00 |
| IUPAC Name | 1,2-bis[(3-bromo-4,5-dimethoxyphenyl)methylideneamino]guanidine |
| SMILES | COc1cc(C=NN=C(N)NN=Cc2cc(Br)c(OC)c(OC)c2)cc(Br)c1OC |
| InChI | InChI=1S/C19H21Br2N5O4/c1-27-15-7-11(5-13(20)17(15)29-3)9-23-25-19(22)26-24-10-12-6-14(21)18(30-4)16(8-12)28-2/h5-10H,1-4H3,(H3,22,25,26) |
| InChIKey | PWLQOBZOIRKPIM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|