C10H13BrN2O2 — CID 110507338
N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]methanamine (PubChem CID 110507338) has the molecular formula C10H13BrN2O2 and a molecular weight of 273.13 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]methanamine.
| Compound Name | N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]methanamine |
|---|---|
| PubChem CID | 110507338 |
| Molecular Formula | C10H13BrN2O2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]methanamine |
| SMILES | CN/N=C/c1cc(Br)c(OC)c(OC)c1 |
| InChI | InChI=1S/C10H13BrN2O2/c1-12-13-6-7-4-8(11)10(15-3)9(5-7)14-2/h4-6,12H,1-3H3/b13-6+ |
| InChIKey | UYEUWXAYYTZYSM-AWNIVKPZSA-N |
| XLogP | 2.02 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|