C15H14BrNO4S — CID 110518789
(NZ)-N-[(3-bromo-4,5-dimethoxyphenyl)methylidene]benzenesulfonamide (PubChem CID 110518789) has the molecular formula C15H14BrNO4S and a molecular weight of 384.25 g/mol. Its IUPAC name is (NZ)-N-[(3-bromo-4,5-dimethoxyphenyl)methylidene]benzenesulfonamide.
| Compound Name | (NZ)-N-[(3-bromo-4,5-dimethoxyphenyl)methylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 110518789 |
| Molecular Formula | C15H14BrNO4S |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | (NZ)-N-[(3-bromo-4,5-dimethoxyphenyl)methylidene]benzenesulfonamide |
| SMILES | COc1cc(/C=N\S(=O)(=O)c2ccccc2)cc(Br)c1OC |
| InChI | InChI=1S/C15H14BrNO4S/c1-20-14-9-11(8-13(16)15(14)21-2)10-17-22(18,19)12-6-4-3-5-7-12/h3-10H,1-2H3/b17-10- |
| InChIKey | ZCPSWYCLSVBVJU-YVLHZVERSA-N |
| XLogP | 3.27 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|