C18H20BrNO4S — CID 110519011
(NZ)-N-[(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylidene]-4-methylbenzenesulfonamide (PubChem CID 110519011) has the molecular formula C18H20BrNO4S and a molecular weight of 426.33 g/mol. Its IUPAC name is (NZ)-N-[(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NZ)-N-[(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 110519011 |
| Molecular Formula | C18H20BrNO4S |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | (NZ)-N-[(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylidene]-4-methylbenzenesulfonamide |
| SMILES | COc1cc(/C=N\S(=O)(=O)c2ccc(C)cc2)cc(Br)c1OC(C)C |
| InChI | InChI=1S/C18H20BrNO4S/c1-12(2)24-18-16(19)9-14(10-17(18)23-4)11-20-25(21,22)15-7-5-13(3)6-8-15/h5-12H,1-4H3/b20-11- |
| InChIKey | SFJUIGOKWJTSFD-JAIQZWGSSA-N |
| XLogP | 4.36 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|