C16H16BrNO4S — CID 136873764
(NZ)-N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-4-methylbenzenesulfonamide (PubChem CID 136873764) has the molecular formula C16H16BrNO4S and a molecular weight of 398.28 g/mol. Its IUPAC name is (NZ)-N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NZ)-N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 136873764 |
| Molecular Formula | C16H16BrNO4S |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | (NZ)-N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-4-methylbenzenesulfonamide |
| SMILES | CCOc1cc(/C=N\S(=O)(=O)c2ccc(C)cc2)cc(Br)c1O |
| InChI | InChI=1S/C16H16BrNO4S/c1-3-22-15-9-12(8-14(17)16(15)19)10-18-23(20,21)13-6-4-11(2)5-7-13/h4-10,19H,3H2,1-2H3/b18-10- |
| InChIKey | XWVIZPRTAWDLIJ-ZDLGFXPLSA-N |
| XLogP | 3.67 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|