C15H13BrClNO4S — CID 135688610
(NE)-N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-4-chlorobenzenesulfonamide (PubChem CID 135688610) has the molecular formula C15H13BrClNO4S and a molecular weight of 418.70 g/mol. Its IUPAC name is (NE)-N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-4-chlorobenzenesulfonamide.
| Compound Name | (NE)-N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 135688610 |
| Molecular Formula | C15H13BrClNO4S |
| Molecular Weight | 418.70 g/mol |
| Exact Mass | 416.94 |
| IUPAC Name | (NE)-N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-4-chlorobenzenesulfonamide |
| SMILES | CCOc1cc(/C=N/S(=O)(=O)c2ccc(Cl)cc2)cc(Br)c1O |
| InChI | InChI=1S/C15H13BrClNO4S/c1-2-22-14-8-10(7-13(16)15(14)19)9-18-23(20,21)12-5-3-11(17)4-6-12/h3-9,19H,2H2,1H3/b18-9+ |
| InChIKey | JXQYXODOJVQMLN-GIJQJNRQSA-N |
| XLogP | 4.01 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.70 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|