C15H13BrCl2N2O4S — CID 135688406
N-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2,5-dichlorobenzenesulfonamide (PubChem CID 135688406) has the molecular formula C15H13BrCl2N2O4S and a molecular weight of 468.16 g/mol. Its IUPAC name is N-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2,5-dichlorobenzenesulfonamide.
| Compound Name | N-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 135688406 |
| Molecular Formula | C15H13BrCl2N2O4S |
| Molecular Weight | 468.16 g/mol |
| Exact Mass | 465.92 |
| IUPAC Name | N-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2,5-dichlorobenzenesulfonamide |
| SMILES | CCOc1cc(/C=N/NS(=O)(=O)c2cc(Cl)ccc2Cl)cc(Br)c1O |
| InChI | InChI=1S/C15H13BrCl2N2O4S/c1-2-24-13-6-9(5-11(16)15(13)21)8-19-20-25(22,23)14-7-10(17)3-4-12(14)18/h3-8,20-21H,2H2,1H3/b19-8+ |
| InChIKey | GEIYVIUNAZJEIM-UFWORHAWSA-N |
| XLogP | 4.17 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.16 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|