C15H14Cl2N2O4S — CID 136873392
4-chloro-N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]benzenesulfonamide (PubChem CID 136873392) has the molecular formula C15H14Cl2N2O4S and a molecular weight of 389.26 g/mol. Its IUPAC name is 4-chloro-N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 136873392 |
| Molecular Formula | C15H14Cl2N2O4S |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 4-chloro-N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]benzenesulfonamide |
| SMILES | CCOc1cc(/C=N/NS(=O)(=O)c2ccc(Cl)cc2)cc(Cl)c1O |
| InChI | InChI=1S/C15H14Cl2N2O4S/c1-2-23-14-8-10(7-13(17)15(14)20)9-18-19-24(21,22)12-5-3-11(16)4-6-12/h3-9,19-20H,2H2,1H3/b18-9+ |
| InChIKey | SESRFHMOZYDMKB-GIJQJNRQSA-N |
| XLogP | 3.41 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|