C15H15FN2O4S — CID 136873420
N-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-4-fluorobenzenesulfonamide (PubChem CID 136873420) has the molecular formula C15H15FN2O4S and a molecular weight of 338.36 g/mol. Its IUPAC name is N-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-4-fluorobenzenesulfonamide.
| Compound Name | N-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 136873420 |
| Molecular Formula | C15H15FN2O4S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | N-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-4-fluorobenzenesulfonamide |
| SMILES | CCOc1cc(/C=N/NS(=O)(=O)c2ccc(F)cc2)ccc1O |
| InChI | InChI=1S/C15H15FN2O4S/c1-2-22-15-9-11(3-8-14(15)19)10-17-18-23(20,21)13-6-4-12(16)5-7-13/h3-10,18-19H,2H2,1H3/b17-10+ |
| InChIKey | KAMXNTHHRCAPRB-LICLKQGHSA-N |
| XLogP | 2.24 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|