C16H16FN3O6S — CID 110516378
N-[(E)-(4-ethoxy-3-methoxy-5-nitrophenyl)methylideneamino]-4-fluorobenzenesulfonamide (PubChem CID 110516378) has the molecular formula C16H16FN3O6S and a molecular weight of 397.38 g/mol. Its IUPAC name is N-[(E)-(4-ethoxy-3-methoxy-5-nitrophenyl)methylideneamino]-4-fluorobenzenesulfonamide.
| Compound Name | N-[(E)-(4-ethoxy-3-methoxy-5-nitrophenyl)methylideneamino]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 110516378 |
| Molecular Formula | C16H16FN3O6S |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N-[(E)-(4-ethoxy-3-methoxy-5-nitrophenyl)methylideneamino]-4-fluorobenzenesulfonamide |
| SMILES | CCOc1c(OC)cc(/C=N/NS(=O)(=O)c2ccc(F)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16FN3O6S/c1-3-26-16-14(20(21)22)8-11(9-15(16)25-2)10-18-19-27(23,24)13-6-4-12(17)5-7-13/h4-10,19H,3H2,1-2H3/b18-10+ |
| InChIKey | KFSGWAGBQJDRLW-VCHYOVAHSA-N |
| XLogP | 2.45 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|