C19H24N2O5S — CID 110517091
N-[(E)-(4-ethoxy-3,5-dimethoxyphenyl)methylideneamino]-3,4-dimethylbenzenesulfonamide (PubChem CID 110517091) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-[(E)-(4-ethoxy-3,5-dimethoxyphenyl)methylideneamino]-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-[(E)-(4-ethoxy-3,5-dimethoxyphenyl)methylideneamino]-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110517091 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-[(E)-(4-ethoxy-3,5-dimethoxyphenyl)methylideneamino]-3,4-dimethylbenzenesulfonamide |
| SMILES | CCOc1c(OC)cc(/C=N/NS(=O)(=O)c2ccc(C)c(C)c2)cc1OC |
| InChI | InChI=1S/C19H24N2O5S/c1-6-26-19-17(24-4)10-15(11-18(19)25-5)12-20-21-27(22,23)16-8-7-13(2)14(3)9-16/h7-12,21H,6H2,1-5H3/b20-12+ |
| InChIKey | HQFYRPIAXSRMLA-UDWIEESQSA-N |
| XLogP | 3.03 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|