C18H21N3O7S — CID 110517643
N-[(E)-(3,4-dimethoxy-5-nitrophenyl)methylideneamino]-4-propan-2-yloxybenzenesulfonamide (PubChem CID 110517643) has the molecular formula C18H21N3O7S and a molecular weight of 423.45 g/mol. Its IUPAC name is N-[(E)-(3,4-dimethoxy-5-nitrophenyl)methylideneamino]-4-propan-2-yloxybenzenesulfonamide.
| Compound Name | N-[(E)-(3,4-dimethoxy-5-nitrophenyl)methylideneamino]-4-propan-2-yloxybenzenesulfonamide |
|---|---|
| PubChem CID | 110517643 |
| Molecular Formula | C18H21N3O7S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N-[(E)-(3,4-dimethoxy-5-nitrophenyl)methylideneamino]-4-propan-2-yloxybenzenesulfonamide |
| SMILES | COc1cc(/C=N/NS(=O)(=O)c2ccc(OC(C)C)cc2)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C18H21N3O7S/c1-12(2)28-14-5-7-15(8-6-14)29(24,25)20-19-11-13-9-16(21(22)23)18(27-4)17(10-13)26-3/h5-12,20H,1-4H3/b19-11+ |
| InChIKey | SVIIAPXSFCPTKN-YBFXNURJSA-N |
| XLogP | 2.71 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|