C20H25N3O7S — CID 110517640
N-[(E)-(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]-4-propan-2-yloxybenzenesulfonamide (PubChem CID 110517640) has the molecular formula C20H25N3O7S and a molecular weight of 451.50 g/mol. Its IUPAC name is N-[(E)-(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]-4-propan-2-yloxybenzenesulfonamide.
| Compound Name | N-[(E)-(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]-4-propan-2-yloxybenzenesulfonamide |
|---|---|
| PubChem CID | 110517640 |
| Molecular Formula | C20H25N3O7S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-[(E)-(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]-4-propan-2-yloxybenzenesulfonamide |
| SMILES | CCCOc1c(OC)cc(/C=N/NS(=O)(=O)c2ccc(OC(C)C)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H25N3O7S/c1-5-10-29-20-18(23(24)25)11-15(12-19(20)28-4)13-21-22-31(26,27)17-8-6-16(7-9-17)30-14(2)3/h6-9,11-14,22H,5,10H2,1-4H3/b21-13+ |
| InChIKey | NBCJGCRJQIUMPD-FYJGNVAPSA-N |
| XLogP | 3.49 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|