C18H20N4O8S — CID 110517324
N-[(E)-(3-ethoxy-5-nitro-4-propoxyphenyl)methylideneamino]-3-nitrobenzenesulfonamide (PubChem CID 110517324) has the molecular formula C18H20N4O8S and a molecular weight of 452.45 g/mol. Its IUPAC name is N-[(E)-(3-ethoxy-5-nitro-4-propoxyphenyl)methylideneamino]-3-nitrobenzenesulfonamide.
| Compound Name | N-[(E)-(3-ethoxy-5-nitro-4-propoxyphenyl)methylideneamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 110517324 |
| Molecular Formula | C18H20N4O8S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | N-[(E)-(3-ethoxy-5-nitro-4-propoxyphenyl)methylideneamino]-3-nitrobenzenesulfonamide |
| SMILES | CCCOc1c(OCC)cc(/C=N/NS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N4O8S/c1-3-8-30-18-16(22(25)26)9-13(10-17(18)29-4-2)12-19-20-31(27,28)15-7-5-6-14(11-15)21(23)24/h5-7,9-12,20H,3-4,8H2,1-2H3/b19-12+ |
| InChIKey | DFYDZYPQTZKPTQ-XDHOZWIPSA-N |
| XLogP | 3.00 |
| TPSA | 163.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|