C15H14BrN3O6S — CID 110517357
N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-3-nitrobenzenesulfonamide (PubChem CID 110517357) has the molecular formula C15H14BrN3O6S and a molecular weight of 444.26 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-3-nitrobenzenesulfonamide.
| Compound Name | N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 110517357 |
| Molecular Formula | C15H14BrN3O6S |
| Molecular Weight | 444.26 g/mol |
| Exact Mass | 442.98 |
| IUPAC Name | N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-3-nitrobenzenesulfonamide |
| SMILES | COc1cc(/C=N/NS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc(Br)c1OC |
| InChI | InChI=1S/C15H14BrN3O6S/c1-24-14-7-10(6-13(16)15(14)25-2)9-17-18-26(22,23)12-5-3-4-11(8-12)19(20)21/h3-9,18H,1-2H3/b17-9+ |
| InChIKey | XQDAOKAAEAIKCT-RQZCQDPDSA-N |
| XLogP | 2.69 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|