C15H14BrFN2O4S — CID 110516421
N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-4-fluorobenzenesulfonamide (PubChem CID 110516421) has the molecular formula C15H14BrFN2O4S and a molecular weight of 417.26 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-4-fluorobenzenesulfonamide.
| Compound Name | N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 110516421 |
| Molecular Formula | C15H14BrFN2O4S |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-4-fluorobenzenesulfonamide |
| SMILES | COc1cc(/C=N/NS(=O)(=O)c2ccc(F)cc2)cc(Br)c1OC |
| InChI | InChI=1S/C15H14BrFN2O4S/c1-22-14-8-10(7-13(16)15(14)23-2)9-18-19-24(20,21)12-5-3-11(17)4-6-12/h3-9,19H,1-2H3/b18-9+ |
| InChIKey | VEJPATXRNAHKKQ-GIJQJNRQSA-N |
| XLogP | 2.92 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|